Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Potassium ferricyanide, 99+%, for analysis
CAS: 13746-66-2 Molecular Formula: C6FeK3N6 Molecular Weight (g/mol): 329.25 MDL Number: MFCD00011392 InChI Key: QMTKJUMXUDIUAQ-UHFFFAOYSA-N Synonym: potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 PubChem CID: 26250 SMILES: [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N
| PubChem CID | 26250 |
|---|---|
| CAS | 13746-66-2 |
| Molecular Weight (g/mol) | 329.25 |
| MDL Number | MFCD00011392 |
| SMILES | [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 |
| InChI Key | QMTKJUMXUDIUAQ-UHFFFAOYSA-N |
| Molecular Formula | C6FeK3N6 |
Iron(III) chloride hexahydrate, 99+%, extra pure
CAS: 10025-77-1 Molecular Formula: Cl3FeH12O6 Molecular Weight (g/mol): 270.29 MDL Number: MFCD00149712 InChI Key: NQXWGWZJXJUMQB-UHFFFAOYSA-K Synonym: Ferric chloride hexahydrate IUPAC Name: iron(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 10025-77-1 |
|---|---|
| Molecular Weight (g/mol) | 270.29 |
| MDL Number | MFCD00149712 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Ferric chloride hexahydrate |
| IUPAC Name | iron(3+) hexahydrate trichloride |
| InChI Key | NQXWGWZJXJUMQB-UHFFFAOYSA-K |
| Molecular Formula | Cl3FeH12O6 |
Sodium phosphate, tribasic, pure, anhydrous
CAS: 7601-54-9 Molecular Formula: Na3O4P Molecular Weight (g/mol): 163.94 MDL Number: MFCD00003510 InChI Key: RYFMWSXOAZQYPI-UHFFFAOYSA-K Synonym: trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat PubChem CID: 24243 ChEBI: CHEBI:37583 IUPAC Name: trisodium;phosphate SMILES: [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 24243 |
|---|---|
| CAS | 7601-54-9 |
| Molecular Weight (g/mol) | 163.94 |
| ChEBI | CHEBI:37583 |
| MDL Number | MFCD00003510 |
| SMILES | [O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate,sodium orthophosphate,tromete,tribasic sodium phosphate,phosphoric acid, trisodium salt,oakite,sodium phosphate, anhydrous,trisodium orthophosphate,phosphoric acid trisodium salt,trinatriumphosphat |
| IUPAC Name | trisodium;phosphate |
| InChI Key | RYFMWSXOAZQYPI-UHFFFAOYSA-K |
| Molecular Formula | Na3O4P |
Calcium carbonate, 98%, pure, light powder
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Sodium iodide, ACS, 99.5% min
CAS: 7681-82-5 Molecular Formula: INa Molecular Weight (g/mol): 149.894 MDL Number: MFCD00003532 InChI Key: FVAUCKIRQBBSSJ-UHFFFAOYSA-M Synonym: sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech PubChem CID: 5238 ChEBI: CHEBI:33167 IUPAC Name: sodium;iodide SMILES: [Na+].[I-]
| PubChem CID | 5238 |
|---|---|
| CAS | 7681-82-5 |
| Molecular Weight (g/mol) | 149.894 |
| ChEBI | CHEBI:33167 |
| MDL Number | MFCD00003532 |
| SMILES | [Na+].[I-] |
| Synonym | sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech |
| IUPAC Name | sodium;iodide |
| InChI Key | FVAUCKIRQBBSSJ-UHFFFAOYSA-M |
| Molecular Formula | INa |
Barium nitrate, ACS reagent
CAS: 10022-31-8 Molecular Formula: BaN2O6 Molecular Weight (g/mol): 261.34 MDL Number: MFCD00003442 InChI Key: IWOUKMZUPDVPGQ-UHFFFAOYSA-N Synonym: barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 PubChem CID: 24798 SMILES: [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24798 |
|---|---|
| CAS | 10022-31-8 |
| Molecular Weight (g/mol) | 261.34 |
| MDL Number | MFCD00003442 |
| SMILES | [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 |
| InChI Key | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Molecular Formula | BaN2O6 |
Ammonium sulfate, ultrapure, 99+%
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 IUPAC Name: sulfuric acid diamine SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| IUPAC Name | sulfuric acid diamine |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Ammonium molybdate, 99.99% (metals basis)
CAS: 13106-76-8 Molecular Formula: H8MoN2O4 MDL Number: MFCD00011596
| CAS | 13106-76-8 |
|---|---|
| MDL Number | MFCD00011596 |
| Molecular Formula | H8MoN2O4 |
Titanium(IV) oxide, Aeroxide™ P25
CAS: 13463-67-7 Molecular Formula: O2Ti Molecular Weight (g/mol): 79.87 MDL Number: MFCD00011269 MFCD00210650 InChI Key: GWEVSGVZZGPLCZ-UHFFFAOYSA-N Synonym: titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance PubChem CID: 26042 ChEBI: CHEBI:32234 IUPAC Name: dioxotitanium SMILES: O=[Ti]=O
| PubChem CID | 26042 |
|---|---|
| CAS | 13463-67-7 |
| Molecular Weight (g/mol) | 79.87 |
| ChEBI | CHEBI:32234 |
| MDL Number | MFCD00011269 MFCD00210650 |
| SMILES | O=[Ti]=O |
| Synonym | titanium dioxide,titania,titanium iv oxide,rutile,anatase,brookite,titanium white,flamenco,hombitan,titafrance |
| IUPAC Name | dioxotitanium |
| InChI Key | GWEVSGVZZGPLCZ-UHFFFAOYSA-N |
| Molecular Formula | O2Ti |
Sodium pentacyanonitrosylferrate(III) dihydrate, ACS, 99.0-102.0%
CAS: 13755-38-9 Molecular Formula: C5H4FeN6Na2O3 Molecular Weight (g/mol): 297.95 MDL Number: MFCD00149192 InChI Key: JFPDVRGGFBUORC-UHFFFAOYSA-N Synonym: nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o PubChem CID: 11953895 IUPAC Name: disodium;iron(4+);nitroxyl anion;pentacyanide;dihydrate SMILES: O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+]
| PubChem CID | 11953895 |
|---|---|
| CAS | 13755-38-9 |
| Molecular Weight (g/mol) | 297.95 |
| MDL Number | MFCD00149192 |
| SMILES | O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+] |
| Synonym | nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o |
| IUPAC Name | disodium;iron(4+);nitroxyl anion;pentacyanide;dihydrate |
| InChI Key | JFPDVRGGFBUORC-UHFFFAOYSA-N |
| Molecular Formula | C5H4FeN6Na2O3 |
Ceric Sulfate Solution, 0.1N (N/10) (Certified), Fisher Chemical
CAS: 17106-39-7 Molecular Formula: CeO8S2 Molecular Weight (g/mol): 332.23 MDL Number: MFCD00148852 InChI Key: VZDYWEUILIUIDF-UHFFFAOYSA-J Synonym: ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate PubChem CID: 159684 IUPAC Name: λ⁴-cerium(4+) disulfate SMILES: [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| PubChem CID | 159684 |
|---|---|
| CAS | 17106-39-7 |
| Molecular Weight (g/mol) | 332.23 |
| MDL Number | MFCD00148852 |
| SMILES | [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate |
| IUPAC Name | λ⁴-cerium(4+) disulfate |
| InChI Key | VZDYWEUILIUIDF-UHFFFAOYSA-J |
| Molecular Formula | CeO8S2 |
Cupric Sulfate Anhydrous (Certified ACS), Fisher Chemical
CAS: 7758-98-7 Molecular Formula: CuO4S Molecular Weight (g/mol): 159.602 MDL Number: MFCD00010981 InChI Key: ARUVKPQLZAKDPS-UHFFFAOYSA-L Synonym: copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle PubChem CID: 24462 ChEBI: CHEBI:23414 IUPAC Name: copper;sulfate SMILES: [O-]S(=O)(=O)[O-].[Cu+2]
| PubChem CID | 24462 |
|---|---|
| CAS | 7758-98-7 |
| Molecular Weight (g/mol) | 159.602 |
| ChEBI | CHEBI:23414 |
| MDL Number | MFCD00010981 |
| SMILES | [O-]S(=O)(=O)[O-].[Cu+2] |
| Synonym | copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle |
| IUPAC Name | copper;sulfate |
| InChI Key | ARUVKPQLZAKDPS-UHFFFAOYSA-L |
| Molecular Formula | CuO4S |
Ferrous Ammonium Sulfate Hexahydrate (Crystalline/Certified ACS), Fisher Chemical™
CAS: 7783-85-9 Molecular Formula: FeH20N2O14S2 Molecular Weight (g/mol): 392.13 MDL Number: MFCD00150530 InChI Key: MQLVWQSVRZVNIP-UHFFFAOYSA-L Synonym: Mohr Salt,Iron (II) Ammonium Sulfate Hexahydrate IUPAC Name: λ²-iron(2+) diammonium hexahydrate disulfate SMILES: [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7783-85-9 |
|---|---|
| Molecular Weight (g/mol) | 392.13 |
| MDL Number | MFCD00150530 |
| SMILES | [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | Mohr Salt,Iron (II) Ammonium Sulfate Hexahydrate |
| IUPAC Name | λ²-iron(2+) diammonium hexahydrate disulfate |
| InChI Key | MQLVWQSVRZVNIP-UHFFFAOYSA-L |
| Molecular Formula | FeH20N2O14S2 |
Ferrous Sulfate Heptahydrate (Crystalline), ACS Grade, Fisher Chemical™
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |
Ferrous Sulfate Heptahydrate (Crystalline/USP/FCC), Fisher Chemical
CAS: 7782-63-0 Molecular Formula: FeH14O11S Molecular Weight (g/mol): 278.01 MDL Number: MFCD00149719 InChI Key: SURQXAFEQWPFPV-UHFFFAOYSA-L Synonym: iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate PubChem CID: 62662 ChEBI: CHEBI:75836 IUPAC Name: λ²-iron(2+) heptahydrate sulfate SMILES: O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O
| PubChem CID | 62662 |
|---|---|
| CAS | 7782-63-0 |
| Molecular Weight (g/mol) | 278.01 |
| ChEBI | CHEBI:75836 |
| MDL Number | MFCD00149719 |
| SMILES | O.O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O |
| Synonym | iron ii sulfate heptahydrate,ferrous sulfate heptahydrate,presfersul,melanterite mineral,iron sulfate heptahydrate,iron 2+ sulfate heptahydrate,fesofor,fesotyme,haemofort,ironate |
| IUPAC Name | λ²-iron(2+) heptahydrate sulfate |
| InChI Key | SURQXAFEQWPFPV-UHFFFAOYSA-L |
| Molecular Formula | FeH14O11S |